C20H21NO2S2 — CID 134041326
N-[3-(1,3-dithian-2-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 134041326) has the molecular formula C20H21NO2S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-[3-(1,3-dithian-2-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-[3-(1,3-dithian-2-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 134041326 |
| Molecular Formula | C20H21NO2S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-[3-(1,3-dithian-2-yl)phenyl]-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(Nc1cccc(C2SCCCS2)c1)C1COc2ccccc2C1 |
| InChI | InChI=1S/C20H21NO2S2/c22-19(16-11-14-5-1-2-8-18(14)23-13-16)21-17-7-3-6-15(12-17)20-24-9-4-10-25-20/h1-3,5-8,12,16,20H,4,9-11,13H2,(H,21,22) |
| InChIKey | FJHMVSDQQKHUSL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |