C24H23NO2S — CID 20877862
(4-benzylpiperidin-1-yl)-(4H-thieno[3,2-c]chromen-2-yl)methanone (PubChem CID 20877862) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-(4H-thieno[3,2-c]chromen-2-yl)methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-(4H-thieno[3,2-c]chromen-2-yl)methanone |
|---|---|
| PubChem CID | 20877862 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-(4H-thieno[3,2-c]chromen-2-yl)methanone |
| SMILES | O=C(c1cc2c(s1)-c1ccccc1OC2)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H23NO2S/c26-24(25-12-10-18(11-13-25)14-17-6-2-1-3-7-17)22-15-19-16-27-21-9-5-4-8-20(21)23(19)28-22/h1-9,15,18H,10-14,16H2 |
| InChIKey | ACLGFTXJKNPEKL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |