C18H26N4O3 — CID 46356945
N-[3-(diethylamino)propyl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide (PubChem CID 46356945) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 46356945 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-(4-methyl-2,3-dioxoquinoxalin-1-yl)acetamide |
| SMILES | CCN(CC)CCCNC(=O)Cn1c(=O)c(=O)n(C)c2ccccc21 |
| InChI | InChI=1S/C18H26N4O3/c1-4-21(5-2)12-8-11-19-16(23)13-22-15-10-7-6-9-14(15)20(3)17(24)18(22)25/h6-7,9-10H,4-5,8,11-13H2,1-3H3,(H,19,23) |
| InChIKey | JDQAXCNQMMLQFW-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|