C20H28N4O3 — CID 22422688
N-[3-(diethylamino)propyl]-2-[[2-(1-oxoisoquinolin-2-yl)acetyl]amino]acetamide (PubChem CID 22422688) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-[[2-(1-oxoisoquinolin-2-yl)acetyl]amino]acetamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-[[2-(1-oxoisoquinolin-2-yl)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 22422688 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-[[2-(1-oxoisoquinolin-2-yl)acetyl]amino]acetamide |
| SMILES | CCN(CC)CCCNC(=O)CNC(=O)Cn1ccc2ccccc2c1=O |
| InChI | InChI=1S/C20H28N4O3/c1-3-23(4-2)12-7-11-21-18(25)14-22-19(26)15-24-13-10-16-8-5-6-9-17(16)20(24)27/h5-6,8-10,13H,3-4,7,11-12,14-15H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | PJBRFCXNPOLIHM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|