C23H32N4O3 — CID 46506302
N-[3-(4-methylpiperidin-1-yl)propyl]-3-[[2-(1-oxoisoquinolin-2-yl)acetyl]amino]propanamide (PubChem CID 46506302) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[3-(4-methylpiperidin-1-yl)propyl]-3-[[2-(1-oxoisoquinolin-2-yl)acetyl]amino]propanamide.
| Compound Name | N-[3-(4-methylpiperidin-1-yl)propyl]-3-[[2-(1-oxoisoquinolin-2-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 46506302 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-[3-(4-methylpiperidin-1-yl)propyl]-3-[[2-(1-oxoisoquinolin-2-yl)acetyl]amino]propanamide |
| SMILES | CC1CCN(CCCNC(=O)CCNC(=O)Cn2ccc3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C23H32N4O3/c1-18-8-14-26(15-9-18)13-4-11-24-21(28)7-12-25-22(29)17-27-16-10-19-5-2-3-6-20(19)23(27)30/h2-3,5-6,10,16,18H,4,7-9,11-15,17H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | RLQTWIPMFDEANM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|