C28H38N6O — CID 92876483
1-(1H-benzimidazol-2-yl)-N-[3-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]piperidine-4-carboxamide (PubChem CID 92876483) has the molecular formula C28H38N6O and a molecular weight of 474.65 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-N-[3-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]piperidine-4-carboxamide.
| Compound Name | 1-(1H-benzimidazol-2-yl)-N-[3-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92876483 |
| Molecular Formula | C28H38N6O |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-N-[3-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]propyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)C3CCN(c4nc5ccccc5[nH]4)CC3)C[C@@H]2C)c1 |
| InChI | InChI=1S/C28H38N6O/c1-21-7-5-8-24(19-21)34-18-17-32(20-22(34)2)14-6-13-29-27(35)23-11-15-33(16-12-23)28-30-25-9-3-4-10-26(25)31-28/h3-5,7-10,19,22-23H,6,11-18,20H2,1-2H3,(H,29,35)(H,30,31)/t22-/m0/s1 |
| InChIKey | ZKUZPNSGTVECBC-QFIPXVFZSA-N |
| XLogP | 3.80 |
| TPSA | 67.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|