C26H31FN4O — CID 92881244
(1S)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide (PubChem CID 92881244) has the molecular formula C26H31FN4O and a molecular weight of 434.56 g/mol. Its IUPAC name is (1S)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide.
| Compound Name | (1S)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 92881244 |
| Molecular Formula | C26H31FN4O |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (1S)-N-[3-[4-(2-fluorophenyl)piperazin-1-yl]propyl]-2,3,4,9-tetrahydro-1H-carbazole-1-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ccccc2F)CC1)[C@H]1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C26H31FN4O/c27-22-10-2-4-12-24(22)31-17-15-30(16-18-31)14-6-13-28-26(32)21-9-5-8-20-19-7-1-3-11-23(19)29-25(20)21/h1-4,7,10-12,21,29H,5-6,8-9,13-18H2,(H,28,32)/t21-/m0/s1 |
| InChIKey | NCDJRTOXHXNGQU-NRFANRHFSA-N |
| XLogP | 4.06 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|