C19H27ClN2O2 — CID 124754889
1-(4-chlorophenyl)-N-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]propyl]cyclopropane-1-carboxamide (PubChem CID 124754889) has the molecular formula C19H27ClN2O2 and a molecular weight of 350.89 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]propyl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 124754889 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-(4-chlorophenyl)-N-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]propyl]cyclopropane-1-carboxamide |
| SMILES | O=C(NCCCN1CCCC[C@@H]1CO)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H27ClN2O2/c20-16-7-5-15(6-8-16)19(9-10-19)18(24)21-11-3-13-22-12-2-1-4-17(22)14-23/h5-8,17,23H,1-4,9-14H2,(H,21,24)/t17-/m1/s1 |
| InChIKey | PCFKFYRFAQRSNM-QGZVFWFLSA-N |
| XLogP | 2.72 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|