C20H31ClN2OS — CID 132762741
2-(4-chlorophenyl)sulfanyl-N-[3-(2-ethylpiperidin-1-yl)propyl]butanamide (PubChem CID 132762741) has the molecular formula C20H31ClN2OS and a molecular weight of 383.00 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[3-(2-ethylpiperidin-1-yl)propyl]butanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[3-(2-ethylpiperidin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 132762741 |
| Molecular Formula | C20H31ClN2OS |
| Molecular Weight | 383.00 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[3-(2-ethylpiperidin-1-yl)propyl]butanamide |
| SMILES | CCC(Sc1ccc(Cl)cc1)C(=O)NCCCN1CCCCC1CC |
| InChI | InChI=1S/C20H31ClN2OS/c1-3-17-8-5-6-14-23(17)15-7-13-22-20(24)19(4-2)25-18-11-9-16(21)10-12-18/h9-12,17,19H,3-8,13-15H2,1-2H3,(H,22,24) |
| InChIKey | TWYOXYUIWIIMBY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.00 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|