C21H34N2O3S — CID 125042996
(2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]propanamide (PubChem CID 125042996) has the molecular formula C21H34N2O3S and a molecular weight of 394.58 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]propanamide.
| Compound Name | (2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]propanamide |
|---|---|
| PubChem CID | 125042996 |
| Molecular Formula | C21H34N2O3S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (2S)-2-(3,4-dimethoxyphenyl)sulfanyl-N-[3-[(2S)-2-ethylpiperidin-1-yl]propyl]propanamide |
| SMILES | CC[C@H]1CCCCN1CCCNC(=O)[C@H](C)Sc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H34N2O3S/c1-5-17-9-6-7-13-23(17)14-8-12-22-21(24)16(2)27-18-10-11-19(25-3)20(15-18)26-4/h10-11,15-17H,5-9,12-14H2,1-4H3,(H,22,24)/t16-,17-/m0/s1 |
| InChIKey | TVMNZHMIRCCKJH-IRXDYDNUSA-N |
| XLogP | 3.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|