C19H29NO3S2 — CID 92684572
(2R)-N-(2-cyclohexylsulfanylethyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide (PubChem CID 92684572) has the molecular formula C19H29NO3S2 and a molecular weight of 383.58 g/mol. Its IUPAC name is (2R)-N-(2-cyclohexylsulfanylethyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide.
| Compound Name | (2R)-N-(2-cyclohexylsulfanylethyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 92684572 |
| Molecular Formula | C19H29NO3S2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (2R)-N-(2-cyclohexylsulfanylethyl)-2-(3,4-dimethoxyphenyl)sulfanylpropanamide |
| SMILES | COc1ccc(S[C@H](C)C(=O)NCCSC2CCCCC2)cc1OC |
| InChI | InChI=1S/C19H29NO3S2/c1-14(25-16-9-10-17(22-2)18(13-16)23-3)19(21)20-11-12-24-15-7-5-4-6-8-15/h9-10,13-15H,4-8,11-12H2,1-3H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | VDFSFVJPNHGENN-CQSZACIVSA-N |
| XLogP | 4.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|