C19H30N2O5S2 — CID 125057622
(2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,4-dimethoxy-N-methylsulfonylanilino)propanamide (PubChem CID 125057622) has the molecular formula C19H30N2O5S2 and a molecular weight of 430.59 g/mol. Its IUPAC name is (2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,4-dimethoxy-N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,4-dimethoxy-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 125057622 |
| Molecular Formula | C19H30N2O5S2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (2R)-N-(2-cyclopentylsulfanylethyl)-2-(3,4-dimethoxy-N-methylsulfonylanilino)propanamide |
| SMILES | COc1ccc(N([C@H](C)C(=O)NCCSC2CCCC2)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C19H30N2O5S2/c1-14(19(22)20-11-12-27-16-7-5-6-8-16)21(28(4,23)24)15-9-10-17(25-2)18(13-15)26-3/h9-10,13-14,16H,5-8,11-12H2,1-4H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | IHOFSXZAHBUQNI-CQSZACIVSA-N |
| XLogP | 2.65 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|