C16H23NOS2 — CID 94101620
(2S)-N-(2-cyclopentylsulfanylethyl)-2-phenylsulfanylpropanamide (PubChem CID 94101620) has the molecular formula C16H23NOS2 and a molecular weight of 309.50 g/mol. Its IUPAC name is (2S)-N-(2-cyclopentylsulfanylethyl)-2-phenylsulfanylpropanamide.
| Compound Name | (2S)-N-(2-cyclopentylsulfanylethyl)-2-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 94101620 |
| Molecular Formula | C16H23NOS2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2S)-N-(2-cyclopentylsulfanylethyl)-2-phenylsulfanylpropanamide |
| SMILES | C[C@H](Sc1ccccc1)C(=O)NCCSC1CCCC1 |
| InChI | InChI=1S/C16H23NOS2/c1-13(20-15-9-3-2-4-10-15)16(18)17-11-12-19-14-7-5-6-8-14/h2-4,9-10,13-14H,5-8,11-12H2,1H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | IQNZBSLVKIEEHA-ZDUSSCGKSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|