C20H31NO2S — CID 28576651
(2R)-N-(2-cyclohexylsulfanylethyl)-2-(2-propan-2-ylphenoxy)propanamide (PubChem CID 28576651) has the molecular formula C20H31NO2S and a molecular weight of 349.54 g/mol. Its IUPAC name is (2R)-N-(2-cyclohexylsulfanylethyl)-2-(2-propan-2-ylphenoxy)propanamide.
| Compound Name | (2R)-N-(2-cyclohexylsulfanylethyl)-2-(2-propan-2-ylphenoxy)propanamide |
|---|---|
| PubChem CID | 28576651 |
| Molecular Formula | C20H31NO2S |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | (2R)-N-(2-cyclohexylsulfanylethyl)-2-(2-propan-2-ylphenoxy)propanamide |
| SMILES | CC(C)c1ccccc1O[C@H](C)C(=O)NCCSC1CCCCC1 |
| InChI | InChI=1S/C20H31NO2S/c1-15(2)18-11-7-8-12-19(18)23-16(3)20(22)21-13-14-24-17-9-5-4-6-10-17/h7-8,11-12,15-17H,4-6,9-10,13-14H2,1-3H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | SXMUFGYKIWZRMH-MRXNPFEDSA-N |
| XLogP | 4.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|