C20H29NO2S — CID 133235185
N-(2-cyclopentylsulfanylethyl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide (PubChem CID 133235185) has the molecular formula C20H29NO2S and a molecular weight of 347.52 g/mol. Its IUPAC name is N-(2-cyclopentylsulfanylethyl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide.
| Compound Name | N-(2-cyclopentylsulfanylethyl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide |
|---|---|
| PubChem CID | 133235185 |
| Molecular Formula | C20H29NO2S |
| Molecular Weight | 347.52 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-(2-cyclopentylsulfanylethyl)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide |
| SMILES | CC(Oc1cccc2c1CCCC2)C(=O)NCCSC1CCCC1 |
| InChI | InChI=1S/C20H29NO2S/c1-15(20(22)21-13-14-24-17-9-3-4-10-17)23-19-12-6-8-16-7-2-5-11-18(16)19/h6,8,12,15,17H,2-5,7,9-11,13-14H2,1H3,(H,21,22) |
| InChIKey | HXJCYEWZFIUMHK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.52 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|