C14H19NO2 — CID 133161578
N-methyl-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide (PubChem CID 133161578) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-methyl-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide.
| Compound Name | N-methyl-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide |
|---|---|
| PubChem CID | 133161578 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-methyl-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propanamide |
| SMILES | CNC(=O)C(C)Oc1cccc2c1CCCC2 |
| InChI | InChI=1S/C14H19NO2/c1-10(14(16)15-2)17-13-9-5-7-11-6-3-4-8-12(11)13/h5,7,9-10H,3-4,6,8H2,1-2H3,(H,15,16) |
| InChIKey | MRPOCWGPFGXDHC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |