C21H33NO2 — CID 100544151
(2R)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)-N-(2,4,4-trimethylpentan-2-yl)propanamide (PubChem CID 100544151) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is (2R)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)-N-(2,4,4-trimethylpentan-2-yl)propanamide.
| Compound Name | (2R)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)-N-(2,4,4-trimethylpentan-2-yl)propanamide |
|---|---|
| PubChem CID | 100544151 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | (2R)-2-(5,6,7,8-tetrahydronaphthalen-1-yloxy)-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| SMILES | C[C@@H](Oc1cccc2c1CCCC2)C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C21H33NO2/c1-15(19(23)22-21(5,6)14-20(2,3)4)24-18-13-9-11-16-10-7-8-12-17(16)18/h9,11,13,15H,7-8,10,12,14H2,1-6H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | PVULJSIMYQNNIO-OAHLLOKOSA-N |
| XLogP | 4.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |