C14H19NO3S — CID 43885751
2-(3,4-dimethoxyphenyl)sulfanyl-N-prop-2-enylpropanamide (PubChem CID 43885751) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfanyl-N-prop-2-enylpropanamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfanyl-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 43885751 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfanyl-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Sc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H19NO3S/c1-5-8-15-14(16)10(2)19-11-6-7-12(17-3)13(9-11)18-4/h5-7,9-10H,1,8H2,2-4H3,(H,15,16) |
| InChIKey | NCBKPZCYFHDGHD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|