C19H28N4O3 — CID 126453906
N-[2-[(2S)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-oxo-4-phenylpiperazine-1-carboxamide (PubChem CID 126453906) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[2-[(2S)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-oxo-4-phenylpiperazine-1-carboxamide.
| Compound Name | N-[2-[(2S)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-oxo-4-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 126453906 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-[2-[(2S)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-oxo-4-phenylpiperazine-1-carboxamide |
| SMILES | O=C(NCCN1CCCC[C@H]1CO)N1CCN(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C19H28N4O3/c24-15-17-8-4-5-10-21(17)11-9-20-19(26)22-12-13-23(18(25)14-22)16-6-2-1-3-7-16/h1-3,6-7,17,24H,4-5,8-15H2,(H,20,26)/t17-/m0/s1 |
| InChIKey | MNYLVAZPWZWLRR-KRWDZBQOSA-N |
| XLogP | 0.89 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |