C20H26N4O3 — CID 97454834
1-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(6-phenoxy-3-pyridinyl)urea (PubChem CID 97454834) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(6-phenoxy-3-pyridinyl)urea.
| Compound Name | 1-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(6-phenoxy-3-pyridinyl)urea |
|---|---|
| PubChem CID | 97454834 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-(6-phenoxy-3-pyridinyl)urea |
| SMILES | O=C(NCCN1CCCC[C@@H]1CO)Nc1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C20H26N4O3/c25-15-17-6-4-5-12-24(17)13-11-21-20(26)23-16-9-10-19(22-14-16)27-18-7-2-1-3-8-18/h1-3,7-10,14,17,25H,4-6,11-13,15H2,(H2,21,23,26)/t17-/m1/s1 |
| InChIKey | GTRVECZQADVZCS-QGZVFWFLSA-N |
| XLogP | 2.84 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |