C15H15N3O2 — CID 42878418
1-(6-phenoxy-3-pyridinyl)-3-prop-2-enylurea (PubChem CID 42878418) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-(6-phenoxy-3-pyridinyl)-3-prop-2-enylurea.
| Compound Name | 1-(6-phenoxy-3-pyridinyl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 42878418 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(6-phenoxy-3-pyridinyl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1ccc(Oc2ccccc2)nc1 |
| InChI | InChI=1S/C15H15N3O2/c1-2-10-16-15(19)18-12-8-9-14(17-11-12)20-13-6-4-3-5-7-13/h2-9,11H,1,10H2,(H2,16,18,19) |
| InChIKey | RBFZDEOOAACTBL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|