C21H19N3O2 — CID 109180597
N-(2-phenoxyphenyl)-5-(prop-2-enylamino)pyridine-2-carboxamide (PubChem CID 109180597) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(2-phenoxyphenyl)-5-(prop-2-enylamino)pyridine-2-carboxamide.
| Compound Name | N-(2-phenoxyphenyl)-5-(prop-2-enylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109180597 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-(2-phenoxyphenyl)-5-(prop-2-enylamino)pyridine-2-carboxamide |
| SMILES | C=CCNc1ccc(C(=O)Nc2ccccc2Oc2ccccc2)nc1 |
| InChI | InChI=1S/C21H19N3O2/c1-2-14-22-16-12-13-19(23-15-16)21(25)24-18-10-6-7-11-20(18)26-17-8-4-3-5-9-17/h2-13,15,22H,1,14H2,(H,24,25) |
| InChIKey | XRQOIMXIPYRXFU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|