C15H13F2N3O — CID 109180618
N-(3,4-difluorophenyl)-5-(prop-2-enylamino)pyridine-2-carboxamide (PubChem CID 109180618) has the molecular formula C15H13F2N3O and a molecular weight of 289.29 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-5-(prop-2-enylamino)pyridine-2-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-5-(prop-2-enylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109180618 |
| Molecular Formula | C15H13F2N3O |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-5-(prop-2-enylamino)pyridine-2-carboxamide |
| SMILES | C=CCNc1ccc(C(=O)Nc2ccc(F)c(F)c2)nc1 |
| InChI | InChI=1S/C15H13F2N3O/c1-2-7-18-11-4-6-14(19-9-11)15(21)20-10-3-5-12(16)13(17)8-10/h2-6,8-9,18H,1,7H2,(H,20,21) |
| InChIKey | CXCNXEWTCJXLEU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|