C13H14N4O2 — CID 109180619
N-(5-methyl-1,2-oxazol-3-yl)-5-(prop-2-enylamino)pyridine-2-carboxamide (PubChem CID 109180619) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-5-(prop-2-enylamino)pyridine-2-carboxamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-5-(prop-2-enylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109180619 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-5-(prop-2-enylamino)pyridine-2-carboxamide |
| SMILES | C=CCNc1ccc(C(=O)Nc2cc(C)on2)nc1 |
| InChI | InChI=1S/C13H14N4O2/c1-3-6-14-10-4-5-11(15-8-10)13(18)16-12-7-9(2)19-17-12/h3-5,7-8,14H,1,6H2,2H3,(H,16,17,18) |
| InChIKey | VJHAUVQGTDOUEC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|