C19H28N4O3 — CID 97443663
1-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]urea (PubChem CID 97443663) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]urea.
| Compound Name | 1-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 97443663 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 1-[2-[(2R)-2-(hydroxymethyl)piperidin-1-yl]ethyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]urea |
| SMILES | O=C(NCCN1CCCC[C@@H]1CO)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C19H28N4O3/c24-14-17-4-1-2-11-22(17)13-10-20-19(26)21-15-6-8-16(9-7-15)23-12-3-5-18(23)25/h6-9,17,24H,1-5,10-14H2,(H2,20,21,26)/t17-/m1/s1 |
| InChIKey | XFJKMSCZDNKMGE-QGZVFWFLSA-N |
| XLogP | 1.78 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |