C21H25N3O2 — CID 42286968
(2S)-1-cyclobutyl-N-(6-phenoxy-3-pyridinyl)piperidine-2-carboxamide (PubChem CID 42286968) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2S)-1-cyclobutyl-N-(6-phenoxy-3-pyridinyl)piperidine-2-carboxamide.
| Compound Name | (2S)-1-cyclobutyl-N-(6-phenoxy-3-pyridinyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 42286968 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (2S)-1-cyclobutyl-N-(6-phenoxy-3-pyridinyl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)nc1)[C@@H]1CCCCN1C1CCC1 |
| InChI | InChI=1S/C21H25N3O2/c25-21(19-11-4-5-14-24(19)17-7-6-8-17)23-16-12-13-20(22-15-16)26-18-9-2-1-3-10-18/h1-3,9-10,12-13,15,17,19H,4-8,11,14H2,(H,23,25)/t19-/m0/s1 |
| InChIKey | HBPGYSGAUXCSQR-IBGZPJMESA-N |
| XLogP | 4.22 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |