C20H23N3O4 — CID 56852437
1-(2-methoxyacetyl)-N-(6-phenoxy-3-pyridinyl)piperidine-4-carboxamide (PubChem CID 56852437) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-(2-methoxyacetyl)-N-(6-phenoxy-3-pyridinyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-methoxyacetyl)-N-(6-phenoxy-3-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56852437 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-(2-methoxyacetyl)-N-(6-phenoxy-3-pyridinyl)piperidine-4-carboxamide |
| SMILES | COCC(=O)N1CCC(C(=O)Nc2ccc(Oc3ccccc3)nc2)CC1 |
| InChI | InChI=1S/C20H23N3O4/c1-26-14-19(24)23-11-9-15(10-12-23)20(25)22-16-7-8-18(21-13-16)27-17-5-3-2-4-6-17/h2-8,13,15H,9-12,14H2,1H3,(H,22,25) |
| InChIKey | QUHQBVXYHWMFKZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |