C22H21N3O3S — CID 42101147
N-(6-phenoxy-3-pyridinyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 42101147) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-(6-phenoxy-3-pyridinyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(6-phenoxy-3-pyridinyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 42101147 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(6-phenoxy-3-pyridinyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)nc1)C1CCN(C(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C22H21N3O3S/c26-21(16-10-12-25(13-11-16)22(27)19-7-4-14-29-19)24-17-8-9-20(23-15-17)28-18-5-2-1-3-6-18/h1-9,14-16H,10-13H2,(H,24,26) |
| InChIKey | ZKIZZXJDPKJJPC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |