C25H31N3O3 — CID 50831942
N-[6-[4-(4-methylpiperidine-1-carbonyl)phenoxy]-3-pyridinyl]cyclohexanecarboxamide (PubChem CID 50831942) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[6-[4-(4-methylpiperidine-1-carbonyl)phenoxy]-3-pyridinyl]cyclohexanecarboxamide.
| Compound Name | N-[6-[4-(4-methylpiperidine-1-carbonyl)phenoxy]-3-pyridinyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 50831942 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | N-[6-[4-(4-methylpiperidine-1-carbonyl)phenoxy]-3-pyridinyl]cyclohexanecarboxamide |
| SMILES | CC1CCN(C(=O)c2ccc(Oc3ccc(NC(=O)C4CCCCC4)cn3)cc2)CC1 |
| InChI | InChI=1S/C25H31N3O3/c1-18-13-15-28(16-14-18)25(30)20-7-10-22(11-8-20)31-23-12-9-21(17-26-23)27-24(29)19-5-3-2-4-6-19/h7-12,17-19H,2-6,13-16H2,1H3,(H,27,29) |
| InChIKey | OHYUYVXONURJPT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |