C27H28N2O5 — CID 46409832
N-[4-(2-methoxyphenoxy)phenyl]-1-(2-phenoxyacetyl)piperidine-4-carboxamide (PubChem CID 46409832) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is N-[4-(2-methoxyphenoxy)phenyl]-1-(2-phenoxyacetyl)piperidine-4-carboxamide.
| Compound Name | N-[4-(2-methoxyphenoxy)phenyl]-1-(2-phenoxyacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46409832 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-[4-(2-methoxyphenoxy)phenyl]-1-(2-phenoxyacetyl)piperidine-4-carboxamide |
| SMILES | COc1ccccc1Oc1ccc(NC(=O)C2CCN(C(=O)COc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H28N2O5/c1-32-24-9-5-6-10-25(24)34-23-13-11-21(12-14-23)28-27(31)20-15-17-29(18-16-20)26(30)19-33-22-7-3-2-4-8-22/h2-14,20H,15-19H2,1H3,(H,28,31) |
| InChIKey | WWOTYHHGMDJZIB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |