C26H27N5O2 — CID 45197081
1-[(1-methylbenzimidazol-2-yl)methyl]-N-(6-phenoxy-3-pyridinyl)piperidine-2-carboxamide (PubChem CID 45197081) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 1-[(1-methylbenzimidazol-2-yl)methyl]-N-(6-phenoxy-3-pyridinyl)piperidine-2-carboxamide.
| Compound Name | 1-[(1-methylbenzimidazol-2-yl)methyl]-N-(6-phenoxy-3-pyridinyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 45197081 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 1-[(1-methylbenzimidazol-2-yl)methyl]-N-(6-phenoxy-3-pyridinyl)piperidine-2-carboxamide |
| SMILES | Cn1c(CN2CCCCC2C(=O)Nc2ccc(Oc3ccccc3)nc2)nc2ccccc21 |
| InChI | InChI=1S/C26H27N5O2/c1-30-22-12-6-5-11-21(22)29-24(30)18-31-16-8-7-13-23(31)26(32)28-19-14-15-25(27-17-19)33-20-9-3-2-4-10-20/h2-6,9-12,14-15,17,23H,7-8,13,16,18H2,1H3,(H,28,32) |
| InChIKey | NEMVKWYFIXIZIW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |