C23H24N4O2 — CID 42518595
(2S)-N-(6-phenoxy-3-pyridinyl)-1-(pyridin-2-ylmethyl)piperidine-2-carboxamide (PubChem CID 42518595) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2S)-N-(6-phenoxy-3-pyridinyl)-1-(pyridin-2-ylmethyl)piperidine-2-carboxamide.
| Compound Name | (2S)-N-(6-phenoxy-3-pyridinyl)-1-(pyridin-2-ylmethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 42518595 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (2S)-N-(6-phenoxy-3-pyridinyl)-1-(pyridin-2-ylmethyl)piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)nc1)[C@@H]1CCCCN1Cc1ccccn1 |
| InChI | InChI=1S/C23H24N4O2/c28-23(21-11-5-7-15-27(21)17-19-8-4-6-14-24-19)26-18-12-13-22(25-16-18)29-20-9-2-1-3-10-20/h1-4,6,8-10,12-14,16,21H,5,7,11,15,17H2,(H,26,28)/t21-/m0/s1 |
| InChIKey | QTWORGOSEGXUTH-NRFANRHFSA-N |
| XLogP | 4.26 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |