C20H25ClN4O — CID 97451631
1-[2-[(2S)-1-benzylpiperidin-2-yl]ethyl]-3-(6-chloro-3-pyridinyl)urea (PubChem CID 97451631) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is 1-[2-[(2S)-1-benzylpiperidin-2-yl]ethyl]-3-(6-chloro-3-pyridinyl)urea.
| Compound Name | 1-[2-[(2S)-1-benzylpiperidin-2-yl]ethyl]-3-(6-chloro-3-pyridinyl)urea |
|---|---|
| PubChem CID | 97451631 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-[2-[(2S)-1-benzylpiperidin-2-yl]ethyl]-3-(6-chloro-3-pyridinyl)urea |
| SMILES | O=C(NCC[C@@H]1CCCCN1Cc1ccccc1)Nc1ccc(Cl)nc1 |
| InChI | InChI=1S/C20H25ClN4O/c21-19-10-9-17(14-23-19)24-20(26)22-12-11-18-8-4-5-13-25(18)15-16-6-2-1-3-7-16/h1-3,6-7,9-10,14,18H,4-5,8,11-13,15H2,(H2,22,24,26)/t18-/m0/s1 |
| InChIKey | LOJQOVBVFCVWBQ-SFHVURJKSA-N |
| XLogP | 4.30 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|