C20H30N4O2 — CID 126453267
N-[2-[(2R)-1-benzylpiperidin-2-yl]ethyl]-3-oxo-1,4-diazepane-1-carboxamide (PubChem CID 126453267) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is N-[2-[(2R)-1-benzylpiperidin-2-yl]ethyl]-3-oxo-1,4-diazepane-1-carboxamide.
| Compound Name | N-[2-[(2R)-1-benzylpiperidin-2-yl]ethyl]-3-oxo-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 126453267 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | N-[2-[(2R)-1-benzylpiperidin-2-yl]ethyl]-3-oxo-1,4-diazepane-1-carboxamide |
| SMILES | O=C1CN(C(=O)NCC[C@H]2CCCCN2Cc2ccccc2)CCCN1 |
| InChI | InChI=1S/C20H30N4O2/c25-19-16-24(14-6-11-21-19)20(26)22-12-10-18-9-4-5-13-23(18)15-17-7-2-1-3-8-17/h1-3,7-8,18H,4-6,9-16H2,(H,21,25)(H,22,26)/t18-/m1/s1 |
| InChIKey | GSWOEUSEPZIOKG-GOSISDBHSA-N |
| XLogP | 1.96 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |