C18H24N4OS — CID 131894060
2-amino-N-[2-(1-benzylpiperidin-2-yl)ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 131894060) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 2-amino-N-[2-(1-benzylpiperidin-2-yl)ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-[2-(1-benzylpiperidin-2-yl)ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 131894060 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2-amino-N-[2-(1-benzylpiperidin-2-yl)ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | Nc1ncc(C(=O)NCCC2CCCCN2Cc2ccccc2)s1 |
| InChI | InChI=1S/C18H24N4OS/c19-18-21-12-16(24-18)17(23)20-10-9-15-8-4-5-11-22(15)13-14-6-2-1-3-7-14/h1-3,6-7,12,15H,4-5,8-11,13H2,(H2,19,21)(H,20,23) |
| InChIKey | RMXATYXRORZRDY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |