C17H25N7O — CID 126450941
1-[2-[(2S)-1-benzylpiperidin-2-yl]ethyl]-3-(2H-tetrazol-5-ylmethyl)urea (PubChem CID 126450941) has the molecular formula C17H25N7O and a molecular weight of 343.44 g/mol. Its IUPAC name is 1-[2-[(2S)-1-benzylpiperidin-2-yl]ethyl]-3-(2H-tetrazol-5-ylmethyl)urea.
| Compound Name | 1-[2-[(2S)-1-benzylpiperidin-2-yl]ethyl]-3-(2H-tetrazol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 126450941 |
| Molecular Formula | C17H25N7O |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-[2-[(2S)-1-benzylpiperidin-2-yl]ethyl]-3-(2H-tetrazol-5-ylmethyl)urea |
| SMILES | O=C(NCC[C@@H]1CCCCN1Cc1ccccc1)NCc1nn[nH]n1 |
| InChI | InChI=1S/C17H25N7O/c25-17(19-12-16-20-22-23-21-16)18-10-9-15-8-4-5-11-24(15)13-14-6-2-1-3-7-14/h1-3,6-7,15H,4-5,8-13H2,(H2,18,19,25)(H,20,21,22,23)/t15-/m0/s1 |
| InChIKey | OWHWKAPCYCEETQ-HNNXBMFYSA-N |
| XLogP | 1.44 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |