C13H19N3O3S — CID 122022218
4-[(4-thiophen-2-ylpiperazine-1-carbonyl)amino]butanoic acid (PubChem CID 122022218) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[(4-thiophen-2-ylpiperazine-1-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(4-thiophen-2-ylpiperazine-1-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 122022218 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-[(4-thiophen-2-ylpiperazine-1-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCN(c2cccs2)CC1 |
| InChI | InChI=1S/C13H19N3O3S/c17-12(18)4-1-5-14-13(19)16-8-6-15(7-9-16)11-3-2-10-20-11/h2-3,10H,1,4-9H2,(H,14,19)(H,17,18) |
| InChIKey | JVMVIDWCNCWYFI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|