C15H19N5O3S — CID 122021678
4-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazine-1-carbonyl)amino]butanoic acid (PubChem CID 122021678) has the molecular formula C15H19N5O3S and a molecular weight of 349.42 g/mol. Its IUPAC name is 4-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazine-1-carbonyl)amino]butanoic acid.
| Compound Name | 4-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazine-1-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 122021678 |
| Molecular Formula | C15H19N5O3S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 4-[(4-thieno[2,3-d]pyrimidin-4-ylpiperazine-1-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)N1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C15H19N5O3S/c21-12(22)2-1-4-16-15(23)20-7-5-19(6-8-20)13-11-3-9-24-14(11)18-10-17-13/h3,9-10H,1-2,4-8H2,(H,16,23)(H,21,22) |
| InChIKey | GLURCLTZGGFHCL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|