C21H22N8OS2 — CID 174973437
bis(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methanone (PubChem CID 174973437) has the molecular formula C21H22N8OS2 and a molecular weight of 466.60 g/mol. Its IUPAC name is bis(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methanone.
| Compound Name | bis(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 174973437 |
| Molecular Formula | C21H22N8OS2 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | bis(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)methanone |
| SMILES | O=C(N1CCN(c2ncnc3sccc23)CC1)N1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C21H22N8OS2/c30-21(28-7-3-26(4-8-28)17-15-1-11-31-19(15)24-13-22-17)29-9-5-27(6-10-29)18-16-2-12-32-20(16)25-14-23-18/h1-2,11-14H,3-10H2 |
| InChIKey | REJDFPPAZRZXKK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 81.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |