C12H14N4OS — CID 2098585
1-thieno[2,3-d]pyrimidin-4-ylpiperidine-4-carboxamide (PubChem CID 2098585) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 1-thieno[2,3-d]pyrimidin-4-ylpiperidine-4-carboxamide.
| Compound Name | 1-thieno[2,3-d]pyrimidin-4-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 2098585 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-thieno[2,3-d]pyrimidin-4-ylpiperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C12H14N4OS/c13-10(17)8-1-4-16(5-2-8)11-9-3-6-18-12(9)15-7-14-11/h3,6-8H,1-2,4-5H2,(H2,13,17) |
| InChIKey | RPXGINQEFCZKPL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |