C14H19N5S2 — CID 63342372
2-methyl-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)propanethioamide (PubChem CID 63342372) has the molecular formula C14H19N5S2 and a molecular weight of 321.48 g/mol. Its IUPAC name is 2-methyl-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)propanethioamide.
| Compound Name | 2-methyl-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)propanethioamide |
|---|---|
| PubChem CID | 63342372 |
| Molecular Formula | C14H19N5S2 |
| Molecular Weight | 321.48 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-methyl-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)propanethioamide |
| SMILES | CC(C)(C(N)=S)N1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C14H19N5S2/c1-14(2,13(15)20)19-6-4-18(5-7-19)11-10-3-8-21-12(10)17-9-16-11/h3,8-9H,4-7H2,1-2H3,(H2,15,20) |
| InChIKey | YBUWMVXOOZXXPA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|