About 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol
2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol (PubChem CID 39817579) has the molecular formula C14H20N4OS
and a molecular weight of 292.41 g/mol. Its IUPAC name is 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol |
| PubChem CID | 39817579 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol |
| SMILES | CN(CCO)C1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C14H20N4OS/c1-17(7-8-19)11-2-5-18(6-3-11)13-12-4-9-20-14(12)16-10-15-13/h4,9-11,19H,2-3,5-8H2,1H3 |
| InChIKey | UJFSRZHTQDLHGG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol?
The IUPAC name of 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol (CID 39817579) is 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol.
What is the SMILES notation for 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol?
The canonical SMILES for 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol is CN(CCO)C1CCN(c2ncnc3sccc23)CC1.
What is the InChIKey of 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol?
The InChIKey is UJFSRZHTQDLHGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4OS/c1-17(7-8-19)11-2-5-18(6-3-11)13-12-4-9-20-14(12)16-10-15-13/h4,9-11,19H,2-3,5-8H2,1H3.
What are the key properties of 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol?
2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol has a molecular weight of 292.41 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-(1-thieno[2,3-d]pyrimidin-4-ylpiperidin-4-yl)amino]ethanol is sourced from PubChem (CID 39817579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).