C11H12ClN3S — CID 63390055
4-[3-(chloromethyl)pyrrolidin-1-yl]thieno[2,3-d]pyrimidine (PubChem CID 63390055) has the molecular formula C11H12ClN3S and a molecular weight of 253.76 g/mol. Its IUPAC name is 4-[3-(chloromethyl)pyrrolidin-1-yl]thieno[2,3-d]pyrimidine.
| Compound Name | 4-[3-(chloromethyl)pyrrolidin-1-yl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 63390055 |
| Molecular Formula | C11H12ClN3S |
| Molecular Weight | 253.76 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 4-[3-(chloromethyl)pyrrolidin-1-yl]thieno[2,3-d]pyrimidine |
| SMILES | ClCC1CCN(c2ncnc3sccc23)C1 |
| InChI | InChI=1S/C11H12ClN3S/c12-5-8-1-3-15(6-8)10-9-2-4-16-11(9)14-7-13-10/h2,4,7-8H,1,3,5-6H2 |
| InChIKey | WGNJTOJNQDFZBZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|