C13H18N4OS — CID 63309935
2-(4-thieno[2,3-d]pyrimidin-4-yl-1,4-diazepan-1-yl)ethanol (PubChem CID 63309935) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-(4-thieno[2,3-d]pyrimidin-4-yl-1,4-diazepan-1-yl)ethanol.
| Compound Name | 2-(4-thieno[2,3-d]pyrimidin-4-yl-1,4-diazepan-1-yl)ethanol |
|---|---|
| PubChem CID | 63309935 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-(4-thieno[2,3-d]pyrimidin-4-yl-1,4-diazepan-1-yl)ethanol |
| SMILES | OCCN1CCCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C13H18N4OS/c18-8-7-16-3-1-4-17(6-5-16)12-11-2-9-19-13(11)15-10-14-12/h2,9-10,18H,1,3-8H2 |
| InChIKey | VCTGOMKFZWGUDM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |