C18H20N4OS — CID 95318735
(1R)-1-phenyl-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol (PubChem CID 95318735) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is (1R)-1-phenyl-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol.
| Compound Name | (1R)-1-phenyl-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol |
|---|---|
| PubChem CID | 95318735 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (1R)-1-phenyl-2-(4-thieno[2,3-d]pyrimidin-4-ylpiperazin-1-yl)ethanol |
| SMILES | O[C@@H](CN1CCN(c2ncnc3sccc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C18H20N4OS/c23-16(14-4-2-1-3-5-14)12-21-7-9-22(10-8-21)17-15-6-11-24-18(15)20-13-19-17/h1-6,11,13,16,23H,7-10,12H2/t16-/m0/s1 |
| InChIKey | NYLZUACUKZZZAZ-INIZCTEOSA-N |
| XLogP | 2.55 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |