C17H18N4O2S2 — CID 9109711
4-(4-benzylsulfonylpiperazin-1-yl)thieno[2,3-d]pyrimidine (PubChem CID 9109711) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-(4-benzylsulfonylpiperazin-1-yl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-(4-benzylsulfonylpiperazin-1-yl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 9109711 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 4-(4-benzylsulfonylpiperazin-1-yl)thieno[2,3-d]pyrimidine |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C17H18N4O2S2/c22-25(23,12-14-4-2-1-3-5-14)21-9-7-20(8-10-21)16-15-6-11-24-17(15)19-13-18-16/h1-6,11,13H,7-10,12H2 |
| InChIKey | DTJKUVFOMRNWDV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |