C16H15ClN4O2S2 — CID 9108134
4-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine (PubChem CID 9108134) has the molecular formula C16H15ClN4O2S2 and a molecular weight of 394.91 g/mol. Its IUPAC name is 4-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine.
| Compound Name | 4-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 9108134 |
| Molecular Formula | C16H15ClN4O2S2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 4-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]thieno[2,3-d]pyrimidine |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCN(c2ncnc3sccc23)CC1 |
| InChI | InChI=1S/C16H15ClN4O2S2/c17-13-3-1-2-4-14(13)25(22,23)21-8-6-20(7-9-21)15-12-5-10-24-16(12)19-11-18-15/h1-5,10-11H,6-9H2 |
| InChIKey | RSELGTYSHFPRFW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |