C20H28N6O2S — CID 56922983
4-(4-benzylsulfonylpiperazin-1-yl)-6-(4-methylpiperazin-1-yl)pyrimidine (PubChem CID 56922983) has the molecular formula C20H28N6O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is 4-(4-benzylsulfonylpiperazin-1-yl)-6-(4-methylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-(4-benzylsulfonylpiperazin-1-yl)-6-(4-methylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 56922983 |
| Molecular Formula | C20H28N6O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 4-(4-benzylsulfonylpiperazin-1-yl)-6-(4-methylpiperazin-1-yl)pyrimidine |
| SMILES | CN1CCN(c2cc(N3CCN(S(=O)(=O)Cc4ccccc4)CC3)ncn2)CC1 |
| InChI | InChI=1S/C20H28N6O2S/c1-23-7-9-24(10-8-23)19-15-20(22-17-21-19)25-11-13-26(14-12-25)29(27,28)16-18-5-3-2-4-6-18/h2-6,15,17H,7-14,16H2,1H3 |
| InChIKey | ZAZJYPBYVDRDCM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |