C19H25BrN6O2S — CID 122343646
4-[4-(2-bromophenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidine (PubChem CID 122343646) has the molecular formula C19H25BrN6O2S and a molecular weight of 481.42 g/mol. Its IUPAC name is 4-[4-(2-bromophenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-[4-(2-bromophenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 122343646 |
| Molecular Formula | C19H25BrN6O2S |
| Molecular Weight | 481.42 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 4-[4-(2-bromophenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidine |
| SMILES | CN1CCN(c2cc(N3CCN(S(=O)(=O)c4ccccc4Br)CC3)ncn2)CC1 |
| InChI | InChI=1S/C19H25BrN6O2S/c1-23-6-8-24(9-7-23)18-14-19(22-15-21-18)25-10-12-26(13-11-25)29(27,28)17-5-3-2-4-16(17)20/h2-5,14-15H,6-13H2,1H3 |
| InChIKey | CGTCPAOBCQWGSI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |