C20H28N6O3S — CID 56921805
4-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidine (PubChem CID 56921805) has the molecular formula C20H28N6O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 56921805 |
| Molecular Formula | C20H28N6O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3cc(N4CCN(C)CC4)ncn3)CC2)cc1 |
| InChI | InChI=1S/C20H28N6O3S/c1-23-7-9-24(10-8-23)19-15-20(22-16-21-19)25-11-13-26(14-12-25)30(27,28)18-5-3-17(29-2)4-6-18/h3-6,15-16H,7-14H2,1-2H3 |
| InChIKey | ISDIYRIDPRGFBO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 82.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |